C27H18Br2N2O4 — CID 160540929
3-[[4,5-dibromo-9-[(2,3-dihydroxyphenyl)methylideneamino]fluoren-9-yl]iminomethyl]benzene-1,2-diol (PubChem CID 160540929) has the molecular formula C27H18Br2N2O4 and a molecular weight of 594.26 g/mol. Its IUPAC name is 3-[[4,5-dibromo-9-[(2,3-dihydroxyphenyl)methylideneamino]fluoren-9-yl]iminomethyl]benzene-1,2-diol.
| Compound Name | 3-[[4,5-dibromo-9-[(2,3-dihydroxyphenyl)methylideneamino]fluoren-9-yl]iminomethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 160540929 |
| Molecular Formula | C27H18Br2N2O4 |
| Molecular Weight | 594.26 g/mol |
| Exact Mass | 591.96 |
| IUPAC Name | 3-[[4,5-dibromo-9-[(2,3-dihydroxyphenyl)methylideneamino]fluoren-9-yl]iminomethyl]benzene-1,2-diol |
| SMILES | Oc1cccc(C=NC2(N=Cc3cccc(O)c3O)c3cccc(Br)c3-c3c(Br)cccc32)c1O |
| InChI | InChI=1S/C27H18Br2N2O4/c28-19-9-3-7-17-23(19)24-18(8-4-10-20(24)29)27(17,30-13-15-5-1-11-21(32)25(15)34)31-14-16-6-2-12-22(33)26(16)35/h1-14,32-35H |
| InChIKey | ADNXOKIIWYNFEB-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.26 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|