C15H18FN3O — CID 159730656
(3S,9aS)-3-(3-fluoro-4-isocyano-5-methylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]oxazine (PubChem CID 159730656) has the molecular formula C15H18FN3O and a molecular weight of 275.33 g/mol. Its IUPAC name is (3S,9aS)-3-(3-fluoro-4-isocyano-5-methylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]oxazine.
| Compound Name | (3S,9aS)-3-(3-fluoro-4-isocyano-5-methylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 159730656 |
| Molecular Formula | C15H18FN3O |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | (3S,9aS)-3-(3-fluoro-4-isocyano-5-methylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]oxazine |
| SMILES | [C-]#[N+]c1c(C)cc([C@H]2CN3CCNC[C@H]3CO2)cc1F |
| InChI | InChI=1S/C15H18FN3O/c1-10-5-11(6-13(16)15(10)17-2)14-8-19-4-3-18-7-12(19)9-20-14/h5-6,12,14,18H,3-4,7-9H2,1H3/t12-,14+/m0/s1 |
| InChIKey | NBEREZCHWFZCMF-GXTWGEPZSA-N |
| XLogP | 2.03 |
| TPSA | 28.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|