C16H20FN3O — CID 123876764
(7S,10aR)-7-(4-fluoro-3-isocyano-2-methylphenyl)-2,3,4,6,7,9,10,10a-octahydro-1H-pyrazino[1,2-d][1,4]oxazepine (PubChem CID 123876764) has the molecular formula C16H20FN3O and a molecular weight of 289.35 g/mol. Its IUPAC name is (7S,10aR)-7-(4-fluoro-3-isocyano-2-methylphenyl)-2,3,4,6,7,9,10,10a-octahydro-1H-pyrazino[1,2-d][1,4]oxazepine.
| Compound Name | (7S,10aR)-7-(4-fluoro-3-isocyano-2-methylphenyl)-2,3,4,6,7,9,10,10a-octahydro-1H-pyrazino[1,2-d][1,4]oxazepine |
|---|---|
| PubChem CID | 123876764 |
| Molecular Formula | C16H20FN3O |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | (7S,10aR)-7-(4-fluoro-3-isocyano-2-methylphenyl)-2,3,4,6,7,9,10,10a-octahydro-1H-pyrazino[1,2-d][1,4]oxazepine |
| SMILES | [C-]#[N+]c1c(F)ccc([C@H]2CN3CCNC[C@H]3CCO2)c1C |
| InChI | InChI=1S/C16H20FN3O/c1-11-13(3-4-14(17)16(11)18-2)15-10-20-7-6-19-9-12(20)5-8-21-15/h3-4,12,15,19H,5-10H2,1H3/t12-,15-/m1/s1 |
| InChIKey | KQOAVSNBIBMMAM-IUODEOHRSA-N |
| XLogP | 2.42 |
| TPSA | 28.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|