C27H35N5O3 — CID 159737529
2-azido-N-[(4S,5S)-6-ethyl-4,5-dimethyl-2-[phenyl-[4-(propan-2-ylideneamino)phenyl]methoxy]oxan-3-yl]acetamide (PubChem CID 159737529) has the molecular formula C27H35N5O3 and a molecular weight of 477.61 g/mol. Its IUPAC name is 2-azido-N-[(4S,5S)-6-ethyl-4,5-dimethyl-2-[phenyl-[4-(propan-2-ylideneamino)phenyl]methoxy]oxan-3-yl]acetamide.
| Compound Name | 2-azido-N-[(4S,5S)-6-ethyl-4,5-dimethyl-2-[phenyl-[4-(propan-2-ylideneamino)phenyl]methoxy]oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 159737529 |
| Molecular Formula | C27H35N5O3 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | 2-azido-N-[(4S,5S)-6-ethyl-4,5-dimethyl-2-[phenyl-[4-(propan-2-ylideneamino)phenyl]methoxy]oxan-3-yl]acetamide |
| SMILES | CCC1OC(OC(c2ccccc2)c2ccc(N=C(C)C)cc2)C(NC(=O)CN=[N+]=[N-])[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C27H35N5O3/c1-6-23-18(4)19(5)25(31-24(33)16-29-32-28)27(34-23)35-26(20-10-8-7-9-11-20)21-12-14-22(15-13-21)30-17(2)3/h7-15,18-19,23,25-27H,6,16H2,1-5H3,(H,31,33)/t18-,19-,23?,25?,26?,27?/m0/s1 |
| InChIKey | GBLGQEMCTHYRIB-JUJAQCORSA-N |
| XLogP | 6.11 |
| TPSA | 108.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|