C36H57B2ClN2O6 — CID 159754796
1-(2-chloroethyl)pyrrolidine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol;1-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]pyrrolidine (PubChem CID 159754796) has the molecular formula C36H57B2ClN2O6 and a molecular weight of 670.94 g/mol. Its IUPAC name is 1-(2-chloroethyl)pyrrolidine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol;1-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]pyrrolidine.
| Compound Name | 1-(2-chloroethyl)pyrrolidine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol;1-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]pyrrolidine |
|---|---|
| PubChem CID | 159754796 |
| Molecular Formula | C36H57B2ClN2O6 |
| Molecular Weight | 670.94 g/mol |
| Exact Mass | 670.41 |
| IUPAC Name | 1-(2-chloroethyl)pyrrolidine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol;1-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]pyrrolidine |
| SMILES | CC1(C)OB(c2ccc(O)cc2)OC1(C)C.CC1(C)OB(c2ccc(OCCN3CCCC3)cc2)OC1(C)C.ClCCN1CCCC1 |
| InChI | InChI=1S/C18H28BNO3.C12H17BO3.C6H12ClN/c1-17(2)18(3,4)23-19(22-17)15-7-9-16(10-8-15)21-14-13-20-11-5-6-12-20;1-11(2)12(3,4)16-13(15-11)9-5-7-10(14)8-6-9;7-3-6-8-4-1-2-5-8/h7-10H,5-6,11-14H2,1-4H3;5-8,14H,1-4H3;1-6H2 |
| InChIKey | NECSFSZBYHLNOM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.94 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|