C25H41BN2O6 — CID 172696861
2-tert-butyl-4-[2-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethoxy]ethyl]piperazine-1-carboxylic acid (PubChem CID 172696861) has the molecular formula C25H41BN2O6 and a molecular weight of 476.42 g/mol. Its IUPAC name is 2-tert-butyl-4-[2-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethoxy]ethyl]piperazine-1-carboxylic acid.
| Compound Name | 2-tert-butyl-4-[2-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethoxy]ethyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 172696861 |
| Molecular Formula | C25H41BN2O6 |
| Molecular Weight | 476.42 g/mol |
| Exact Mass | 476.31 |
| IUPAC Name | 2-tert-butyl-4-[2-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethoxy]ethyl]piperazine-1-carboxylic acid |
| SMILES | CC(C)(C)C1CN(CCOCCOc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)CCN1C(=O)O |
| InChI | InChI=1S/C25H41BN2O6/c1-23(2,3)21-18-27(12-13-28(21)22(29)30)14-15-31-16-17-32-20-10-8-19(9-11-20)26-33-24(4,5)25(6,7)34-26/h8-11,21H,12-18H2,1-7H3,(H,29,30) |
| InChIKey | CKZFTOQBLGOJKT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 80.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|