C21H24Cl2N4O3S — CID 159775858
1-[C-(2-amino-3,3-dimethylbut-1-enyl)-N-(4-methylsulfonylphenyl)carbonimidoyl]-3-(2,3-dichlorophenyl)urea (PubChem CID 159775858) has the molecular formula C21H24Cl2N4O3S and a molecular weight of 483.42 g/mol. Its IUPAC name is 1-[C-(2-amino-3,3-dimethylbut-1-enyl)-N-(4-methylsulfonylphenyl)carbonimidoyl]-3-(2,3-dichlorophenyl)urea.
| Compound Name | 1-[C-(2-amino-3,3-dimethylbut-1-enyl)-N-(4-methylsulfonylphenyl)carbonimidoyl]-3-(2,3-dichlorophenyl)urea |
|---|---|
| PubChem CID | 159775858 |
| Molecular Formula | C21H24Cl2N4O3S |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | 1-[C-(2-amino-3,3-dimethylbut-1-enyl)-N-(4-methylsulfonylphenyl)carbonimidoyl]-3-(2,3-dichlorophenyl)urea |
| SMILES | CC(C)(C)C(N)=C/C(=N\c1ccc(S(C)(=O)=O)cc1)NC(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C21H24Cl2N4O3S/c1-21(2,3)17(24)12-18(25-13-8-10-14(11-9-13)31(4,29)30)27-20(28)26-16-7-5-6-15(22)19(16)23/h5-12H,24H2,1-4H3,(H2,25,26,27,28) |
| InChIKey | OUKMVXBCJMMCSW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|