C24H25I2N3O7 — CID 159802891
ethyl 4-(2-amino-5-iodophenyl)-4-oxobutanoate;ethyl 2-(6-iodo-2,4-dioxo-1H-quinazolin-3-yl)acetate (PubChem CID 159802891) has the molecular formula C24H25I2N3O7 and a molecular weight of 721.29 g/mol. Its IUPAC name is ethyl 4-(2-amino-5-iodophenyl)-4-oxobutanoate;ethyl 2-(6-iodo-2,4-dioxo-1H-quinazolin-3-yl)acetate.
| Compound Name | ethyl 4-(2-amino-5-iodophenyl)-4-oxobutanoate;ethyl 2-(6-iodo-2,4-dioxo-1H-quinazolin-3-yl)acetate |
|---|---|
| PubChem CID | 159802891 |
| Molecular Formula | C24H25I2N3O7 |
| Molecular Weight | 721.29 g/mol |
| Exact Mass | 720.98 |
| IUPAC Name | ethyl 4-(2-amino-5-iodophenyl)-4-oxobutanoate;ethyl 2-(6-iodo-2,4-dioxo-1H-quinazolin-3-yl)acetate |
| SMILES | CCOC(=O)CCC(=O)c1cc(I)ccc1N.CCOC(=O)Cn1c(=O)[nH]c2ccc(I)cc2c1=O |
| InChI | InChI=1S/C12H11IN2O4.C12H14INO3/c1-2-19-10(16)6-15-11(17)8-5-7(13)3-4-9(8)14-12(15)18;1-2-17-12(16)6-5-11(15)9-7-8(13)3-4-10(9)14/h3-5H,2,6H2,1H3,(H,14,18);3-4,7H,2,5-6,14H2,1H3 |
| InChIKey | NKAFWKQZTQDQCH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 150.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|