C32H45NO6S2 — CID 159863763
ethyl 2-(4-methoxyphenyl)sulfanyl-2,5-dimethylhex-4-enoate;N-hydroxy-2-(4-methoxyphenyl)sulfanyl-2,5-dimethylhex-4-enamide (PubChem CID 159863763) has the molecular formula C32H45NO6S2 and a molecular weight of 603.85 g/mol. Its IUPAC name is ethyl 2-(4-methoxyphenyl)sulfanyl-2,5-dimethylhex-4-enoate;N-hydroxy-2-(4-methoxyphenyl)sulfanyl-2,5-dimethylhex-4-enamide.
| Compound Name | ethyl 2-(4-methoxyphenyl)sulfanyl-2,5-dimethylhex-4-enoate;N-hydroxy-2-(4-methoxyphenyl)sulfanyl-2,5-dimethylhex-4-enamide |
|---|---|
| PubChem CID | 159863763 |
| Molecular Formula | C32H45NO6S2 |
| Molecular Weight | 603.85 g/mol |
| Exact Mass | 603.27 |
| IUPAC Name | ethyl 2-(4-methoxyphenyl)sulfanyl-2,5-dimethylhex-4-enoate;N-hydroxy-2-(4-methoxyphenyl)sulfanyl-2,5-dimethylhex-4-enamide |
| SMILES | CCOC(=O)C(C)(CC=C(C)C)Sc1ccc(OC)cc1.COc1ccc(SC(C)(CC=C(C)C)C(=O)NO)cc1 |
| InChI | InChI=1S/C17H24O3S.C15H21NO3S/c1-6-20-16(18)17(4,12-11-13(2)3)21-15-9-7-14(19-5)8-10-15;1-11(2)9-10-15(3,14(17)16-18)20-13-7-5-12(19-4)6-8-13/h7-11H,6,12H2,1-5H3;5-9,18H,10H2,1-4H3,(H,16,17) |
| InChIKey | NRLZUCHDPRUHMC-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.85 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|