C15H21NO5S — CID 70133338
amino 2-(4-methoxyphenyl)sulfonyl-2,5-dimethylhex-4-enoate (PubChem CID 70133338) has the molecular formula C15H21NO5S and a molecular weight of 327.40 g/mol. Its IUPAC name is amino 2-(4-methoxyphenyl)sulfonyl-2,5-dimethylhex-4-enoate.
| Compound Name | amino 2-(4-methoxyphenyl)sulfonyl-2,5-dimethylhex-4-enoate |
|---|---|
| PubChem CID | 70133338 |
| Molecular Formula | C15H21NO5S |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | amino 2-(4-methoxyphenyl)sulfonyl-2,5-dimethylhex-4-enoate |
| SMILES | COc1ccc(S(=O)(=O)C(C)(CC=C(C)C)C(=O)ON)cc1 |
| InChI | InChI=1S/C15H21NO5S/c1-11(2)9-10-15(3,14(17)21-16)22(18,19)13-7-5-12(20-4)6-8-13/h5-9H,10,16H2,1-4H3 |
| InChIKey | DWIVIVWCXIQKLG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|