C15H21N5O — CID 159876464
(2S)-3-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)iminomethyl]heptan-2-ol (PubChem CID 159876464) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is (2S)-3-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)iminomethyl]heptan-2-ol.
| Compound Name | (2S)-3-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)iminomethyl]heptan-2-ol |
|---|---|
| PubChem CID | 159876464 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | (2S)-3-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)iminomethyl]heptan-2-ol |
| SMILES | CCCCC(/C=N/c1nc(N)nc2cccnc12)[C@H](C)O |
| InChI | InChI=1S/C15H21N5O/c1-3-4-6-11(10(2)21)9-18-14-13-12(7-5-8-17-13)19-15(16)20-14/h5,7-11,21H,3-4,6H2,1-2H3,(H2,16,19,20)/b18-9+/t10-,11?/m0/s1 |
| InChIKey | NSYVDMUUIKDZCK-BPWBTACQSA-N |
| XLogP | 2.50 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|