C15H13N5O — CID 145149430
2-(2-aminopyrido[3,2-d]pyrimidin-4-yl)imino-2-phenylethanol (PubChem CID 145149430) has the molecular formula C15H13N5O and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-(2-aminopyrido[3,2-d]pyrimidin-4-yl)imino-2-phenylethanol.
| Compound Name | 2-(2-aminopyrido[3,2-d]pyrimidin-4-yl)imino-2-phenylethanol |
|---|---|
| PubChem CID | 145149430 |
| Molecular Formula | C15H13N5O |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-(2-aminopyrido[3,2-d]pyrimidin-4-yl)imino-2-phenylethanol |
| SMILES | Nc1nc(/N=C(\CO)c2ccccc2)c2ncccc2n1 |
| InChI | InChI=1S/C15H13N5O/c16-15-19-11-7-4-8-17-13(11)14(20-15)18-12(9-21)10-5-2-1-3-6-10/h1-8,21H,9H2,(H2,16,19,20)/b18-12+ |
| InChIKey | GTXNLWKRTXFFIB-LDADJPATSA-N |
| XLogP | 1.72 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|