C28H32BN3O5 — CID 159928364
methyl N-[(1R)-2-oxo-1-phenyl-2-[(2S)-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]-2,5-dihydropyrrol-1-yl]ethyl]carbamate (PubChem CID 159928364) has the molecular formula C28H32BN3O5 and a molecular weight of 501.39 g/mol. Its IUPAC name is methyl N-[(1R)-2-oxo-1-phenyl-2-[(2S)-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]-2,5-dihydropyrrol-1-yl]ethyl]carbamate.
| Compound Name | methyl N-[(1R)-2-oxo-1-phenyl-2-[(2S)-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]-2,5-dihydropyrrol-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 159928364 |
| Molecular Formula | C28H32BN3O5 |
| Molecular Weight | 501.39 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | methyl N-[(1R)-2-oxo-1-phenyl-2-[(2S)-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]-2,5-dihydropyrrol-1-yl]ethyl]carbamate |
| SMILES | COC(=O)N[C@@H](C(=O)N1CC=C[C@H]1C1=Nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2C1)c1ccccc1 |
| InChI | InChI=1S/C28H32BN3O5/c1-27(2)28(3,4)37-29(36-27)20-13-14-21-19(16-20)17-22(30-21)23-12-9-15-32(23)25(33)24(31-26(34)35-5)18-10-7-6-8-11-18/h6-14,16,23-24H,15,17H2,1-5H3,(H,31,34)/t23-,24+/m0/s1 |
| InChIKey | NZHXHLSRFHSASW-BJKOFHAPSA-N |
| XLogP | 3.48 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|