C16H18F2N4O5S — CID 159940538
5,6-difluoro-N-methanehydrazonoyl-9-oxo-1-azatricyclo[6.5.1.04,14]tetradeca-2,4(14),5,7-tetraene-2-carboxamide;methanesulfonic acid (PubChem CID 159940538) has the molecular formula C16H18F2N4O5S and a molecular weight of 416.41 g/mol. Its IUPAC name is 5,6-difluoro-N-methanehydrazonoyl-9-oxo-1-azatricyclo[6.5.1.04,14]tetradeca-2,4(14),5,7-tetraene-2-carboxamide;methanesulfonic acid.
| Compound Name | 5,6-difluoro-N-methanehydrazonoyl-9-oxo-1-azatricyclo[6.5.1.04,14]tetradeca-2,4(14),5,7-tetraene-2-carboxamide;methanesulfonic acid |
|---|---|
| PubChem CID | 159940538 |
| Molecular Formula | C16H18F2N4O5S |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 5,6-difluoro-N-methanehydrazonoyl-9-oxo-1-azatricyclo[6.5.1.04,14]tetradeca-2,4(14),5,7-tetraene-2-carboxamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.NN=CNC(=O)c1cc2c(F)c(F)cc3c2n1CCCCC3=O |
| InChI | InChI=1S/C15H14F2N4O2.CH4O3S/c16-10-5-8-12(22)3-1-2-4-21-11(15(23)19-7-20-18)6-9(13(10)17)14(8)21;1-5(2,3)4/h5-7H,1-4,18H2,(H,19,20,23);1H3,(H,2,3,4) |
| InChIKey | OAUYJCSLOYJJLX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 143.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|