About sulfane;sulfonylurea;urea
sulfane;sulfonylurea;urea (PubChem CID 159945588) has the molecular formula C2H8N4O4S2
and a molecular weight of 216.24 g/mol. Its IUPAC name is sulfane;sulfonylurea;urea.
Molecular Properties
| Compound Name | sulfane;sulfonylurea;urea |
| PubChem CID | 159945588 |
| Molecular Formula | C2H8N4O4S2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.00 |
| IUPAC Name | sulfane;sulfonylurea;urea |
| SMILES | NC(=O)N=S(=O)=O.NC(N)=O.S |
| InChI | InChI=1S/CH2N2O3S.CH4N2O.H2S/c2-1(4)3-7(5)6;2-1(3)4;/h(H2,2,4);(H4,2,3,4);1H2 |
| InChIKey | AUVCFACDVVWTHO-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 158.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze sulfane;sulfonylurea;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfane;sulfonylurea;urea?
The IUPAC name of sulfane;sulfonylurea;urea (CID 159945588) is sulfane;sulfonylurea;urea.
What is the SMILES notation for sulfane;sulfonylurea;urea?
The canonical SMILES for sulfane;sulfonylurea;urea is NC(=O)N=S(=O)=O.NC(N)=O.S.
What is the InChIKey of sulfane;sulfonylurea;urea?
The InChIKey is AUVCFACDVVWTHO-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2N2O3S.CH4N2O.H2S/c2-1(4)3-7(5)6;2-1(3)4;/h(H2,2,4);(H4,2,3,4);1H2.
What are the key properties of sulfane;sulfonylurea;urea?
sulfane;sulfonylurea;urea has a molecular weight of 216.24 g/mol, XLogP of -1.74, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sulfane;sulfonylurea;urea is sourced from PubChem (CID 159945588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).