About CID 172688574
CID 172688574 (PubChem CID 172688574) has the molecular formula CH2MgN2O3S
and a molecular weight of 146.41 g/mol.
Molecular Properties
| Compound Name | CID 172688574 |
| PubChem CID | 172688574 |
| Molecular Formula | CH2MgN2O3S |
| Molecular Weight | 146.41 g/mol |
| Exact Mass | 145.96 |
| IUPAC Name | — |
| SMILES | NC(=O)N=S(=O)=O.[Mg] |
| InChI | InChI=1S/CH2N2O3S.Mg/c2-1(4)3-7(5)6;/h(H2,2,4); |
| InChIKey | BJCRTCKLGZRPEA-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.41 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 172688574 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172688574?
The IUPAC name of CID 172688574 (CID 172688574) is not available.
What is the SMILES notation for CID 172688574?
The canonical SMILES for CID 172688574 is NC(=O)N=S(=O)=O.[Mg].
What is the InChIKey of CID 172688574?
The InChIKey is BJCRTCKLGZRPEA-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2N2O3S.Mg/c2-1(4)3-7(5)6;/h(H2,2,4);.
What are the key properties of CID 172688574?
CID 172688574 has a molecular weight of 146.41 g/mol, XLogP of -1.25, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172688574 is sourced from PubChem (CID 172688574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).