About azane;N-sulfonylacetamide
azane;N-sulfonylacetamide (PubChem CID 174881843) has the molecular formula C2H6N2O3S
and a molecular weight of 138.15 g/mol. Its IUPAC name is azane;N-sulfonylacetamide.
Molecular Properties
| Compound Name | azane;N-sulfonylacetamide |
| PubChem CID | 174881843 |
| Molecular Formula | C2H6N2O3S |
| Molecular Weight | 138.15 g/mol |
| Exact Mass | 138.01 |
| IUPAC Name | azane;N-sulfonylacetamide |
| SMILES | CC(=O)N=S(=O)=O.N |
| InChI | InChI=1S/C2H3NO3S.H3N/c1-2(4)3-7(5)6;/h1H3;1H3 |
| InChIKey | CIDHIXWZLASVQY-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.15 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;N-sulfonylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;N-sulfonylacetamide?
The IUPAC name of azane;N-sulfonylacetamide (CID 174881843) is azane;N-sulfonylacetamide.
What is the SMILES notation for azane;N-sulfonylacetamide?
The canonical SMILES for azane;N-sulfonylacetamide is CC(=O)N=S(=O)=O.N.
What is the InChIKey of azane;N-sulfonylacetamide?
The InChIKey is CIDHIXWZLASVQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3NO3S.H3N/c1-2(4)3-7(5)6;/h1H3;1H3.
What are the key properties of azane;N-sulfonylacetamide?
azane;N-sulfonylacetamide has a molecular weight of 138.15 g/mol, XLogP of -0.24, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;N-sulfonylacetamide is sourced from PubChem (CID 174881843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).