C28H33Cl2N3O2 — CID 159956103
3-(3,4-dichlorophenyl)-1-[[2-(2-oxobutyl)phenyl]methyl]-1-(1-pent-4-ynylpiperidin-4-yl)urea (PubChem CID 159956103) has the molecular formula C28H33Cl2N3O2 and a molecular weight of 514.50 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-[[2-(2-oxobutyl)phenyl]methyl]-1-(1-pent-4-ynylpiperidin-4-yl)urea.
| Compound Name | 3-(3,4-dichlorophenyl)-1-[[2-(2-oxobutyl)phenyl]methyl]-1-(1-pent-4-ynylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 159956103 |
| Molecular Formula | C28H33Cl2N3O2 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-[[2-(2-oxobutyl)phenyl]methyl]-1-(1-pent-4-ynylpiperidin-4-yl)urea |
| SMILES | C#CCCCN1CCC(N(Cc2ccccc2CC(=O)CC)C(=O)Nc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C28H33Cl2N3O2/c1-3-5-8-15-32-16-13-24(14-17-32)33(28(35)31-23-11-12-26(29)27(30)19-23)20-22-10-7-6-9-21(22)18-25(34)4-2/h1,6-7,9-12,19,24H,4-5,8,13-18,20H2,2H3,(H,31,35) |
| InChIKey | PWGNEDHKXFQWOV-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|