C7H7PW — CID 160523766
(3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten (PubChem CID 160523766) has the molecular formula C7H7PW and a molecular weight of 305.95 g/mol. Its IUPAC name is (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten.
| Compound Name | (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten |
|---|---|
| PubChem CID | 160523766 |
| Molecular Formula | C7H7PW |
| Molecular Weight | 305.95 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten |
| SMILES | C#CC(C=C)=CC(P)=[W] |
| InChI | InChI=1S/C7H7P.W/c1-3-7(4-2)5-6-8;/h1,4-5H,2,8H2; |
| InChIKey | XORUODXZAXASCA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.95 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|