About (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten
(3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten (PubChem CID 160523766) has the molecular formula C7H7PW
and a molecular weight of 305.95 g/mol. Its IUPAC name is (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten.
Molecular Properties
| Compound Name | (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten |
| PubChem CID | 160523766 |
| Molecular Formula | C7H7PW |
| Molecular Weight | 305.95 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten |
| SMILES | C#CC(C=C)=CC(P)=[W] |
| InChI | InChI=1S/C7H7P.W/c1-3-7(4-2)5-6-8;/h1,4-5H,2,8H2; |
| InChIKey | XORUODXZAXASCA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.95 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten?
The IUPAC name of (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten (CID 160523766) is (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten.
What is the SMILES notation for (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten?
The canonical SMILES for (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten is C#CC(C=C)=CC(P)=[W].
What is the InChIKey of (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten?
The InChIKey is XORUODXZAXASCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7P.W/c1-3-7(4-2)5-6-8;/h1,4-5H,2,8H2;.
What are the key properties of (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten?
(3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten has a molecular weight of 305.95 g/mol, XLogP of 1.28, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten is sourced from PubChem (CID 160523766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).