C33H35NO10 — CID 160539021
[(3S,6S,7R,8S)-3-[2-[3-(acetyloxymethoxy)-4-methoxy-2-pyridinyl]-2-oxoethyl]-8-benzyl-6-methyl-4-oxo-1,5-dioxonan-7-yl] benzoate (PubChem CID 160539021) has the molecular formula C33H35NO10 and a molecular weight of 605.64 g/mol. Its IUPAC name is [(3S,6S,7R,8S)-3-[2-[3-(acetyloxymethoxy)-4-methoxy-2-pyridinyl]-2-oxoethyl]-8-benzyl-6-methyl-4-oxo-1,5-dioxonan-7-yl] benzoate.
| Compound Name | [(3S,6S,7R,8S)-3-[2-[3-(acetyloxymethoxy)-4-methoxy-2-pyridinyl]-2-oxoethyl]-8-benzyl-6-methyl-4-oxo-1,5-dioxonan-7-yl] benzoate |
|---|---|
| PubChem CID | 160539021 |
| Molecular Formula | C33H35NO10 |
| Molecular Weight | 605.64 g/mol |
| Exact Mass | 605.23 |
| IUPAC Name | [(3S,6S,7R,8S)-3-[2-[3-(acetyloxymethoxy)-4-methoxy-2-pyridinyl]-2-oxoethyl]-8-benzyl-6-methyl-4-oxo-1,5-dioxonan-7-yl] benzoate |
| SMILES | COc1ccnc(C(=O)C[C@H]2COC[C@H](Cc3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H](C)OC2=O)c1OCOC(C)=O |
| InChI | InChI=1S/C33H35NO10/c1-21-30(44-32(37)24-12-8-5-9-13-24)25(16-23-10-6-4-7-11-23)18-40-19-26(33(38)43-21)17-27(36)29-31(42-20-41-22(2)35)28(39-3)14-15-34-29/h4-15,21,25-26,30H,16-20H2,1-3H3/t21-,25-,26-,30-/m0/s1 |
| InChIKey | QWNKVGWMYIYZMG-KFWGRROVSA-N |
| XLogP | 4.22 |
| TPSA | 136.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.64 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|