C10H24I2NO7V+ — CID 160556348
carboxy-(2-hydroxyethyl)-dimethylazanium;diiodovanadium;3-(hydroxymethyl)butane-1,2,4-triol (PubChem CID 160556348) has the molecular formula C10H24I2NO7V+ and a molecular weight of 575.05 g/mol. Its IUPAC name is carboxy-(2-hydroxyethyl)-dimethylazanium;diiodovanadium;3-(hydroxymethyl)butane-1,2,4-triol.
| Compound Name | carboxy-(2-hydroxyethyl)-dimethylazanium;diiodovanadium;3-(hydroxymethyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 160556348 |
| Molecular Formula | C10H24I2NO7V+ |
| Molecular Weight | 575.05 g/mol |
| Exact Mass | 574.91 |
| IUPAC Name | carboxy-(2-hydroxyethyl)-dimethylazanium;diiodovanadium;3-(hydroxymethyl)butane-1,2,4-triol |
| SMILES | C[N+](C)(CCO)C(=O)O.I[V]I.OCC(O)C(CO)CO |
| InChI | InChI=1S/C5H11NO3.C5H12O4.2HI.V/c1-6(2,3-4-7)5(8)9;6-1-4(2-7)5(9)3-8;;;/h7H,3-4H2,1-2H3;4-9H,1-3H2;2*1H;/q;;;;+2/p-1 |
| InChIKey | QYSRWMGFVJIVPT-UHFFFAOYSA-M |
| XLogP | -0.56 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.05 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|