C17H21F2NO3 — CID 160558280
tert-butyl 2-[4-(2,4-difluorophenyl)-6-oxopiperidin-3-yl]acetate (PubChem CID 160558280) has the molecular formula C17H21F2NO3 and a molecular weight of 325.36 g/mol. Its IUPAC name is tert-butyl 2-[4-(2,4-difluorophenyl)-6-oxopiperidin-3-yl]acetate.
| Compound Name | tert-butyl 2-[4-(2,4-difluorophenyl)-6-oxopiperidin-3-yl]acetate |
|---|---|
| PubChem CID | 160558280 |
| Molecular Formula | C17H21F2NO3 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | tert-butyl 2-[4-(2,4-difluorophenyl)-6-oxopiperidin-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1CNC(=O)CC1c1ccc(F)cc1F |
| InChI | InChI=1S/C17H21F2NO3/c1-17(2,3)23-16(22)6-10-9-20-15(21)8-13(10)12-5-4-11(18)7-14(12)19/h4-5,7,10,13H,6,8-9H2,1-3H3,(H,20,21) |
| InChIKey | BKZVZDDVBRFVGX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |