C37H45F3O6 — CID 160576404
2-(7-ethoxy-1,1,1-trifluoroheptan-2-yl)-4-[4-(4-octoxyphenyl)benzoyl]oxybenzoic acid (PubChem CID 160576404) has the molecular formula C37H45F3O6 and a molecular weight of 642.76 g/mol. Its IUPAC name is 2-(7-ethoxy-1,1,1-trifluoroheptan-2-yl)-4-[4-(4-octoxyphenyl)benzoyl]oxybenzoic acid.
| Compound Name | 2-(7-ethoxy-1,1,1-trifluoroheptan-2-yl)-4-[4-(4-octoxyphenyl)benzoyl]oxybenzoic acid |
|---|---|
| PubChem CID | 160576404 |
| Molecular Formula | C37H45F3O6 |
| Molecular Weight | 642.76 g/mol |
| Exact Mass | 642.32 |
| IUPAC Name | 2-(7-ethoxy-1,1,1-trifluoroheptan-2-yl)-4-[4-(4-octoxyphenyl)benzoyl]oxybenzoic acid |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)O)c(C(CCCCCOCC)C(F)(F)F)c3)cc2)cc1 |
| InChI | InChI=1S/C37H45F3O6/c1-3-5-6-7-8-12-25-45-30-20-18-28(19-21-30)27-14-16-29(17-15-27)36(43)46-31-22-23-32(35(41)42)33(26-31)34(37(38,39)40)13-10-9-11-24-44-4-2/h14-23,26,34H,3-13,24-25H2,1-2H3,(H,41,42) |
| InChIKey | RBFBDWFIHZBDPQ-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.76 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|