C38H56N8O8S — CID 160593175
tert-butyl 4-[[(6-methoxy-1H-benzimidazol-2-yl)amino]methyl]piperidine-1-carboxylate;tert-butyl 4-[[(4-methoxy-2-nitrophenyl)carbamothioylamino]methyl]piperidine-1-carboxylate (PubChem CID 160593175) has the molecular formula C38H56N8O8S and a molecular weight of 784.98 g/mol. Its IUPAC name is tert-butyl 4-[[(6-methoxy-1H-benzimidazol-2-yl)amino]methyl]piperidine-1-carboxylate;tert-butyl 4-[[(4-methoxy-2-nitrophenyl)carbamothioylamino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(6-methoxy-1H-benzimidazol-2-yl)amino]methyl]piperidine-1-carboxylate;tert-butyl 4-[[(4-methoxy-2-nitrophenyl)carbamothioylamino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 160593175 |
| Molecular Formula | C38H56N8O8S |
| Molecular Weight | 784.98 g/mol |
| Exact Mass | 784.39 |
| IUPAC Name | tert-butyl 4-[[(6-methoxy-1H-benzimidazol-2-yl)amino]methyl]piperidine-1-carboxylate;tert-butyl 4-[[(4-methoxy-2-nitrophenyl)carbamothioylamino]methyl]piperidine-1-carboxylate |
| SMILES | COc1ccc(NC(=S)NCC2CCN(C(=O)OC(C)(C)C)CC2)c([N+](=O)[O-])c1.COc1ccc2nc(NCC3CCN(C(=O)OC(C)(C)C)CC3)[nH]c2c1 |
| InChI | InChI=1S/C19H28N4O5S.C19H28N4O3/c1-19(2,3)28-18(24)22-9-7-13(8-10-22)12-20-17(29)21-15-6-5-14(27-4)11-16(15)23(25)26;1-19(2,3)26-18(24)23-9-7-13(8-10-23)12-20-17-21-15-6-5-14(25-4)11-16(15)22-17/h5-6,11,13H,7-10,12H2,1-4H3,(H2,20,21,29);5-6,11,13H,7-10,12H2,1-4H3,(H2,20,21,22) |
| InChIKey | RDHFVAQJTLDYLU-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 185.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.98 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|