C9H6Na2O7S — CID 160597550
disodium;3-methoxycarbonyl-2-sulfobenzene-5-ide-1-carboxylate (PubChem CID 160597550) has the molecular formula C9H6Na2O7S and a molecular weight of 304.19 g/mol. Its IUPAC name is disodium;3-methoxycarbonyl-2-sulfobenzene-5-ide-1-carboxylate.
| Compound Name | disodium;3-methoxycarbonyl-2-sulfobenzene-5-ide-1-carboxylate |
|---|---|
| PubChem CID | 160597550 |
| Molecular Formula | C9H6Na2O7S |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 303.96 |
| IUPAC Name | disodium;3-methoxycarbonyl-2-sulfobenzene-5-ide-1-carboxylate |
| SMILES | COC(=O)c1c[c-]cc(C(=O)[O-])c1S(=O)(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C9H7O7S.2Na/c1-16-9(12)6-4-2-3-5(8(10)11)7(6)17(13,14)15;;/h3-4H,1H3,(H,10,11)(H,13,14,15);;/q-1;2*+1/p-1 |
| InChIKey | HEPKGMFVFTTYRD-UHFFFAOYSA-M |
| XLogP | -7.11 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | -7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|