C26H23Cl2NO12 — CID 160629050
5-chloro-2-methoxyphenol;methyl 5-(5-chloro-2-methoxyphenoxy)furan-2-carboxylate;methyl 5-nitrofuran-2-carboxylate (PubChem CID 160629050) has the molecular formula C26H23Cl2NO12 and a molecular weight of 612.37 g/mol. Its IUPAC name is 5-chloro-2-methoxyphenol;methyl 5-(5-chloro-2-methoxyphenoxy)furan-2-carboxylate;methyl 5-nitrofuran-2-carboxylate.
| Compound Name | 5-chloro-2-methoxyphenol;methyl 5-(5-chloro-2-methoxyphenoxy)furan-2-carboxylate;methyl 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 160629050 |
| Molecular Formula | C26H23Cl2NO12 |
| Molecular Weight | 612.37 g/mol |
| Exact Mass | 611.06 |
| IUPAC Name | 5-chloro-2-methoxyphenol;methyl 5-(5-chloro-2-methoxyphenoxy)furan-2-carboxylate;methyl 5-nitrofuran-2-carboxylate |
| SMILES | COC(=O)c1ccc(Oc2cc(Cl)ccc2OC)o1.COC(=O)c1ccc([N+](=O)[O-])o1.COc1ccc(Cl)cc1O |
| InChI | InChI=1S/C13H11ClO5.C7H7ClO2.C6H5NO5/c1-16-9-4-3-8(14)7-11(9)19-12-6-5-10(18-12)13(15)17-2;1-10-7-3-2-5(8)4-6(7)9;1-11-6(8)4-2-3-5(12-4)7(9)10/h3-7H,1-2H3;2-4,9H,1H3;2-3H,1H3 |
| InChIKey | RHRNEMOHLDSKTL-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 169.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.37 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|