C17H23F3N4O3 — CID 160645574
methane;(Z)-3-morpholin-4-ylprop-2-enenitrile;4,4,4-trifluoro-2-(morpholin-4-ylmethylidene)-3-oxobutanenitrile (PubChem CID 160645574) has the molecular formula C17H23F3N4O3 and a molecular weight of 388.39 g/mol. Its IUPAC name is methane;(Z)-3-morpholin-4-ylprop-2-enenitrile;4,4,4-trifluoro-2-(morpholin-4-ylmethylidene)-3-oxobutanenitrile.
| Compound Name | methane;(Z)-3-morpholin-4-ylprop-2-enenitrile;4,4,4-trifluoro-2-(morpholin-4-ylmethylidene)-3-oxobutanenitrile |
|---|---|
| PubChem CID | 160645574 |
| Molecular Formula | C17H23F3N4O3 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | methane;(Z)-3-morpholin-4-ylprop-2-enenitrile;4,4,4-trifluoro-2-(morpholin-4-ylmethylidene)-3-oxobutanenitrile |
| SMILES | C.N#C/C=C\N1CCOCC1.N#CC(=CN1CCOCC1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C9H9F3N2O2.C7H10N2O.CH4/c10-9(11,12)8(15)7(5-13)6-14-1-3-16-4-2-14;8-2-1-3-9-4-6-10-7-5-9;/h6H,1-4H2;1,3H,4-7H2;1H4/b;3-1-; |
| InChIKey | RJSXNSCCQJWAJH-XOLITGDFSA-N |
| XLogP | 1.85 |
| TPSA | 89.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|