C37H32FN5O7 — CID 160654684
2-(1,2-benzoxazol-3-yl)acetamide;tert-butyl 3-[2-(1,2-benzoxazol-3-yl)-3,5-dioxocyclopenten-1-yl]-6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraene-10-carboxylate (PubChem CID 160654684) has the molecular formula C37H32FN5O7 and a molecular weight of 677.69 g/mol. Its IUPAC name is 2-(1,2-benzoxazol-3-yl)acetamide;tert-butyl 3-[2-(1,2-benzoxazol-3-yl)-3,5-dioxocyclopenten-1-yl]-6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraene-10-carboxylate.
| Compound Name | 2-(1,2-benzoxazol-3-yl)acetamide;tert-butyl 3-[2-(1,2-benzoxazol-3-yl)-3,5-dioxocyclopenten-1-yl]-6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 160654684 |
| Molecular Formula | C37H32FN5O7 |
| Molecular Weight | 677.69 g/mol |
| Exact Mass | 677.23 |
| IUPAC Name | 2-(1,2-benzoxazol-3-yl)acetamide;tert-butyl 3-[2-(1,2-benzoxazol-3-yl)-3,5-dioxocyclopenten-1-yl]-6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraene-10-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCn2cc(C3=C(c4noc5ccccc45)C(=O)CC3=O)c3cc(F)cc(c32)C1.NC(=O)Cc1noc2ccccc12 |
| InChI | InChI=1S/C28H24FN3O5.C9H8N2O2/c1-28(2,3)36-27(35)32-9-8-31-14-19(18-11-16(29)10-15(13-32)26(18)31)23-20(33)12-21(34)24(23)25-17-6-4-5-7-22(17)37-30-25;10-9(12)5-7-6-3-1-2-4-8(6)13-11-7/h4-7,10-11,14H,8-9,12-13H2,1-3H3;1-4H,5H2,(H2,10,12) |
| InChIKey | RKWUCDTYFLBHRU-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 163.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.69 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|