C37H43BN2O4 — CID 160721791
tert-butyl (2S)-2-[5-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,10-dihydrophenanthren-2-yl]-3H-indol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 160721791) has the molecular formula C37H43BN2O4 and a molecular weight of 590.57 g/mol. Its IUPAC name is tert-butyl (2S)-2-[5-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,10-dihydrophenanthren-2-yl]-3H-indol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[5-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,10-dihydrophenanthren-2-yl]-3H-indol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 160721791 |
| Molecular Formula | C37H43BN2O4 |
| Molecular Weight | 590.57 g/mol |
| Exact Mass | 590.33 |
| IUPAC Name | tert-butyl (2S)-2-[5-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,10-dihydrophenanthren-2-yl]-3H-indol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C1=Nc2ccc(-c3ccc4c(c3)CCc3cc(B5OC(C)(C)C(C)(C)O5)ccc3-4)cc2C1 |
| InChI | InChI=1S/C37H43BN2O4/c1-35(2,3)42-34(41)40-18-8-9-33(40)32-22-27-20-24(13-17-31(27)39-32)23-12-15-29-25(19-23)10-11-26-21-28(14-16-30(26)29)38-43-36(4,5)37(6,7)44-38/h12-17,19-21,33H,8-11,18,22H2,1-7H3/t33-/m0/s1 |
| InChIKey | RCYCJNTVEJQKPU-XIFFEERXSA-N |
| XLogP | 7.45 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.57 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|