C20H25N3O4 — CID 160765029
2-ethylhexyl 2-cyanoprop-2-enoate;4-methyl-5-methylidene-2,6-dioxopyridine-3-carbonitrile (PubChem CID 160765029) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-ethylhexyl 2-cyanoprop-2-enoate;4-methyl-5-methylidene-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | 2-ethylhexyl 2-cyanoprop-2-enoate;4-methyl-5-methylidene-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 160765029 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 2-ethylhexyl 2-cyanoprop-2-enoate;4-methyl-5-methylidene-2,6-dioxopyridine-3-carbonitrile |
| SMILES | C=C(C#N)C(=O)OCC(CC)CCCC.C=C1C(=O)NC(=O)C(C#N)=C1C |
| InChI | InChI=1S/C12H19NO2.C8H6N2O2/c1-4-6-7-11(5-2)9-15-12(14)10(3)8-13;1-4-5(2)7(11)10-8(12)6(4)3-9/h11H,3-7,9H2,1-2H3;2H2,1H3,(H,10,11,12) |
| InChIKey | RYOKHLAWOYIDEM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 120.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|