C35H47FN4O6S — CID 160766835
2-[(3R,4R)-1-[3-[(6-fluoro-2-pyridinyl)sulfanyl]propyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid;2-piperidin-3-ylacetic acid (PubChem CID 160766835) has the molecular formula C35H47FN4O6S and a molecular weight of 670.85 g/mol. Its IUPAC name is 2-[(3R,4R)-1-[3-[(6-fluoro-2-pyridinyl)sulfanyl]propyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid;2-piperidin-3-ylacetic acid.
| Compound Name | 2-[(3R,4R)-1-[3-[(6-fluoro-2-pyridinyl)sulfanyl]propyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid;2-piperidin-3-ylacetic acid |
|---|---|
| PubChem CID | 160766835 |
| Molecular Formula | C35H47FN4O6S |
| Molecular Weight | 670.85 g/mol |
| Exact Mass | 670.32 |
| IUPAC Name | 2-[(3R,4R)-1-[3-[(6-fluoro-2-pyridinyl)sulfanyl]propyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid;2-piperidin-3-ylacetic acid |
| SMILES | COc1ccc2nccc(C(O)CCC3CCN(CCCSc4cccc(F)n4)C[C@@H]3CC(=O)O)c2c1.O=C(O)CC1CCCNC1 |
| InChI | InChI=1S/C28H34FN3O4S.C7H13NO2/c1-36-21-7-8-24-23(17-21)22(10-12-30-24)25(33)9-6-19-11-14-32(18-20(19)16-28(34)35)13-3-15-37-27-5-2-4-26(29)31-27;9-7(10)4-6-2-1-3-8-5-6/h2,4-5,7-8,10,12,17,19-20,25,33H,3,6,9,11,13-16,18H2,1H3,(H,34,35);6,8H,1-5H2,(H,9,10)/t19?,20-,25?;/m0./s1 |
| InChIKey | RYUCYNJCASLWOI-VQRHYKMASA-N |
| XLogP | 5.65 |
| TPSA | 145.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.85 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|