C28H28BBrF2N4O2 — CID 160775006
5-bromo-2,3-dihydro-1H-inden-4-amine;(2-fluoro-4-pyridinyl)boronic acid;5-(2-fluoro-4-pyridinyl)-2,3-dihydro-1H-inden-4-amine (PubChem CID 160775006) has the molecular formula C28H28BBrF2N4O2 and a molecular weight of 581.27 g/mol. Its IUPAC name is 5-bromo-2,3-dihydro-1H-inden-4-amine;(2-fluoro-4-pyridinyl)boronic acid;5-(2-fluoro-4-pyridinyl)-2,3-dihydro-1H-inden-4-amine.
| Compound Name | 5-bromo-2,3-dihydro-1H-inden-4-amine;(2-fluoro-4-pyridinyl)boronic acid;5-(2-fluoro-4-pyridinyl)-2,3-dihydro-1H-inden-4-amine |
|---|---|
| PubChem CID | 160775006 |
| Molecular Formula | C28H28BBrF2N4O2 |
| Molecular Weight | 581.27 g/mol |
| Exact Mass | 580.15 |
| IUPAC Name | 5-bromo-2,3-dihydro-1H-inden-4-amine;(2-fluoro-4-pyridinyl)boronic acid;5-(2-fluoro-4-pyridinyl)-2,3-dihydro-1H-inden-4-amine |
| SMILES | Nc1c(-c2ccnc(F)c2)ccc2c1CCC2.Nc1c(Br)ccc2c1CCC2.OB(O)c1ccnc(F)c1 |
| InChI | InChI=1S/C14H13FN2.C9H10BrN.C5H5BFNO2/c15-13-8-10(6-7-17-13)12-5-4-9-2-1-3-11(9)14(12)16;10-8-5-4-6-2-1-3-7(6)9(8)11;7-5-3-4(6(9)10)1-2-8-5/h4-8H,1-3,16H2;4-5H,1-3,11H2;1-3,9-10H |
| InChIKey | RZVDLRULGQHVQH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.27 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|