C21H23FN6O — CID 160791380
3-[[8-(2-fluoroanilino)-9-phenylpurin-2-yl]amino]propan-1-ol;methane (PubChem CID 160791380) has the molecular formula C21H23FN6O and a molecular weight of 394.45 g/mol. Its IUPAC name is 3-[[8-(2-fluoroanilino)-9-phenylpurin-2-yl]amino]propan-1-ol;methane.
| Compound Name | 3-[[8-(2-fluoroanilino)-9-phenylpurin-2-yl]amino]propan-1-ol;methane |
|---|---|
| PubChem CID | 160791380 |
| Molecular Formula | C21H23FN6O |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 3-[[8-(2-fluoroanilino)-9-phenylpurin-2-yl]amino]propan-1-ol;methane |
| SMILES | C.OCCCNc1ncc2nc(Nc3ccccc3F)n(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C20H19FN6O.CH4/c21-15-9-4-5-10-16(15)24-20-25-17-13-23-19(22-11-6-12-28)26-18(17)27(20)14-7-2-1-3-8-14;/h1-5,7-10,13,28H,6,11-12H2,(H,24,25)(H,22,23,26);1H4 |
| InChIKey | SBWFOWDXNWZSEU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|