C14H27F6N3O4S — CID 160823634
3-[dimethyl-[3-(2,2,3,3,3-pentafluoropropanoylamino)propyl]azaniumyl]propane-1-sulfonate;1-fluoro-N,N-dimethylmethanamine (PubChem CID 160823634) has the molecular formula C14H27F6N3O4S and a molecular weight of 447.44 g/mol. Its IUPAC name is 3-[dimethyl-[3-(2,2,3,3,3-pentafluoropropanoylamino)propyl]azaniumyl]propane-1-sulfonate;1-fluoro-N,N-dimethylmethanamine.
| Compound Name | 3-[dimethyl-[3-(2,2,3,3,3-pentafluoropropanoylamino)propyl]azaniumyl]propane-1-sulfonate;1-fluoro-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 160823634 |
| Molecular Formula | C14H27F6N3O4S |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 3-[dimethyl-[3-(2,2,3,3,3-pentafluoropropanoylamino)propyl]azaniumyl]propane-1-sulfonate;1-fluoro-N,N-dimethylmethanamine |
| SMILES | CN(C)CF.C[N+](C)(CCCNC(=O)C(F)(F)C(F)(F)F)CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C11H19F5N2O4S.C3H8FN/c1-18(2,7-4-8-23(20,21)22)6-3-5-17-9(19)10(12,13)11(14,15)16;1-5(2)3-4/h3-8H2,1-2H3,(H-,17,19,20,21,22);3H2,1-2H3 |
| InChIKey | SFWGMBGZMOIJFA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|