About 2H-dibenzofuran-3-one;dihydrochloride
2H-dibenzofuran-3-one;dihydrochloride (PubChem CID 160827509) has the molecular formula C12H10Cl2O2
and a molecular weight of 257.12 g/mol. Its IUPAC name is 2H-dibenzofuran-3-one;dihydrochloride.
Molecular Properties
| Compound Name | 2H-dibenzofuran-3-one;dihydrochloride |
| PubChem CID | 160827509 |
| Molecular Formula | C12H10Cl2O2 |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 2H-dibenzofuran-3-one;dihydrochloride |
| SMILES | Cl.Cl.O=C1C=c2oc3ccccc3c2=CC1 |
| InChI | InChI=1S/C12H8O2.2ClH/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8;;/h1-4,6-7H,5H2;2*1H |
| InChIKey | SGJKPHFYNRWTHB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-dibenzofuran-3-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-dibenzofuran-3-one;dihydrochloride?
The IUPAC name of 2H-dibenzofuran-3-one;dihydrochloride (CID 160827509) is 2H-dibenzofuran-3-one;dihydrochloride.
What is the SMILES notation for 2H-dibenzofuran-3-one;dihydrochloride?
The canonical SMILES for 2H-dibenzofuran-3-one;dihydrochloride is Cl.Cl.O=C1C=c2oc3ccccc3c2=CC1.
What is the InChIKey of 2H-dibenzofuran-3-one;dihydrochloride?
The InChIKey is SGJKPHFYNRWTHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O2.2ClH/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8;;/h1-4,6-7H,5H2;2*1H.
What are the key properties of 2H-dibenzofuran-3-one;dihydrochloride?
2H-dibenzofuran-3-one;dihydrochloride has a molecular weight of 257.12 g/mol, XLogP of 1.81, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-dibenzofuran-3-one;dihydrochloride is sourced from PubChem (CID 160827509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).