C19H15BrO4 — CID 160844830
(4-bromo-3,5-dimethylphenyl) 3-(3-methylphenyl)prop-2-ynoate;carbon dioxide (PubChem CID 160844830) has the molecular formula C19H15BrO4 and a molecular weight of 387.23 g/mol. Its IUPAC name is (4-bromo-3,5-dimethylphenyl) 3-(3-methylphenyl)prop-2-ynoate;carbon dioxide.
| Compound Name | (4-bromo-3,5-dimethylphenyl) 3-(3-methylphenyl)prop-2-ynoate;carbon dioxide |
|---|---|
| PubChem CID | 160844830 |
| Molecular Formula | C19H15BrO4 |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | (4-bromo-3,5-dimethylphenyl) 3-(3-methylphenyl)prop-2-ynoate;carbon dioxide |
| SMILES | Cc1cccc(C#CC(=O)Oc2cc(C)c(Br)c(C)c2)c1.O=C=O |
| InChI | InChI=1S/C18H15BrO2.CO2/c1-12-5-4-6-15(9-12)7-8-17(20)21-16-10-13(2)18(19)14(3)11-16;2-1-3/h4-6,9-11H,1-3H3; |
| InChIKey | SIMUBOCASUPAJJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|