C20H14GdN4 — CID 160863807
3-deuterio-21,22-dihydroporphyrin;gadolinium (PubChem CID 160863807) has the molecular formula C20H14GdN4 and a molecular weight of 468.62 g/mol. Its IUPAC name is 3-deuterio-21,22-dihydroporphyrin;gadolinium.
| Compound Name | 3-deuterio-21,22-dihydroporphyrin;gadolinium |
|---|---|
| PubChem CID | 160863807 |
| Molecular Formula | C20H14GdN4 |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 3-deuterio-21,22-dihydroporphyrin;gadolinium |
| SMILES | [2H]c1cc2cc3nc(cc4nc(cc5ccc(cc1[nH]2)[nH]5)C=C4)C=C3.[Gd] |
| InChI | InChI=1S/C20H14N4.Gd/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;/h1-12,21-22H;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;/i1D; |
| InChIKey | YNUKZYXCWDCABF-NTODGFBASA-N |
| XLogP | 4.66 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |