C16H28OY-2 — CID 160876652
2,2-dimethylhexan-3-one;2,2-dimethylhex-3-yne;yttrium (PubChem CID 160876652) has the molecular formula C16H28OY-2 and a molecular weight of 325.31 g/mol. Its IUPAC name is 2,2-dimethylhexan-3-one;2,2-dimethylhex-3-yne;yttrium.
| Compound Name | 2,2-dimethylhexan-3-one;2,2-dimethylhex-3-yne;yttrium |
|---|---|
| PubChem CID | 160876652 |
| Molecular Formula | C16H28OY-2 |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 2,2-dimethylhexan-3-one;2,2-dimethylhex-3-yne;yttrium |
| SMILES | [CH2-]CC#CC(C)(C)C.[CH2-]CCC(=O)C(C)(C)C.[Y] |
| InChI | InChI=1S/C8H15O.C8H13.Y/c1-5-6-7(9)8(2,3)4;1-5-6-7-8(2,3)4;/h1,5-6H2,2-4H3;1,5H2,2-4H3;/q2*-1; |
| InChIKey | SINABZRLHCENTR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|