C36H32B15Br3OP — CID 160907501
CID 160907501 (PubChem CID 160907501) has the molecular formula C36H32B15Br3OP and a molecular weight of 913.52 g/mol.
| Compound Name | CID 160907501 |
|---|---|
| PubChem CID | 160907501 |
| Molecular Formula | C36H32B15Br3OP |
| Molecular Weight | 913.52 g/mol |
| Exact Mass | 913.11 |
| IUPAC Name | — |
| SMILES | Brc1ccc2c(c1)C(P(Br)(c1ccccc1)(c1ccccc1)c1ccccc1)CC2.OC1CCc2ccc(Br)cc21.[B][B]B([B])B(B([B])[B])B(B([B])[B])B([B])[B] |
| InChI | InChI=1S/C27H23Br2P.C9H9BrO.B15/c28-22-18-16-21-17-19-27(26(21)20-22)30(29,23-10-4-1-5-11-23,24-12-6-2-7-13-24)25-14-8-3-9-15-25;10-7-3-1-6-2-4-9(11)8(6)5-7;1-9-13(8)15(12(6)7)14(10(2)3)11(4)5/h1-16,18,20,27H,17,19H2;1,3,5,9,11H,2,4H2; |
| InChIKey | KMZOSADIHKWPJJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|