C29H58N2O11SSi — CID 160910529
3,4-dimethyloxolane-2,5-dione;2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonic acid;2-methyl-N-(3-triethoxysilylpropyl)butanamide (PubChem CID 160910529) has the molecular formula C29H58N2O11SSi and a molecular weight of 670.94 g/mol. Its IUPAC name is 3,4-dimethyloxolane-2,5-dione;2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonic acid;2-methyl-N-(3-triethoxysilylpropyl)butanamide.
| Compound Name | 3,4-dimethyloxolane-2,5-dione;2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonic acid;2-methyl-N-(3-triethoxysilylpropyl)butanamide |
|---|---|
| PubChem CID | 160910529 |
| Molecular Formula | C29H58N2O11SSi |
| Molecular Weight | 670.94 g/mol |
| Exact Mass | 670.35 |
| IUPAC Name | 3,4-dimethyloxolane-2,5-dione;2-methyl-2-(2-methylbutanoylamino)propane-1-sulfonic acid;2-methyl-N-(3-triethoxysilylpropyl)butanamide |
| SMILES | CC1C(=O)OC(=O)C1C.CCC(C)C(=O)NC(C)(C)CS(=O)(=O)O.CCO[Si](CCCNC(=O)C(C)CC)(OCC)OCC |
| InChI | InChI=1S/C14H31NO4Si.C9H19NO4S.C6H8O3/c1-6-13(5)14(16)15-11-10-12-20(17-7-2,18-8-3)19-9-4;1-5-7(2)8(11)10-9(3,4)6-15(12,13)14;1-3-4(2)6(8)9-5(3)7/h13H,6-12H2,1-5H3,(H,15,16);7H,5-6H2,1-4H3,(H,10,11)(H,12,13,14);3-4H,1-2H3 |
| InChIKey | SQSFGISVARWCNE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 183.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.94 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|