C22H22N5O4PS — CID 160962027
methyl-[4-[(S)-[(6-oxo-2-pyrazol-1-yl-1H-pyrimidine-5-carbonyl)amino]-phenylmethyl]phenyl]phosphinic acid;sulfane (PubChem CID 160962027) has the molecular formula C22H22N5O4PS and a molecular weight of 483.49 g/mol. Its IUPAC name is methyl-[4-[(S)-[(6-oxo-2-pyrazol-1-yl-1H-pyrimidine-5-carbonyl)amino]-phenylmethyl]phenyl]phosphinic acid;sulfane.
| Compound Name | methyl-[4-[(S)-[(6-oxo-2-pyrazol-1-yl-1H-pyrimidine-5-carbonyl)amino]-phenylmethyl]phenyl]phosphinic acid;sulfane |
|---|---|
| PubChem CID | 160962027 |
| Molecular Formula | C22H22N5O4PS |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | methyl-[4-[(S)-[(6-oxo-2-pyrazol-1-yl-1H-pyrimidine-5-carbonyl)amino]-phenylmethyl]phenyl]phosphinic acid;sulfane |
| SMILES | CP(=O)(O)c1ccc([C@@H](NC(=O)c2cnc(-n3cccn3)[nH]c2=O)c2ccccc2)cc1.S |
| InChI | InChI=1S/C22H20N5O4P.H2S/c1-32(30,31)17-10-8-16(9-11-17)19(15-6-3-2-4-7-15)25-20(28)18-14-23-22(26-21(18)29)27-13-5-12-24-27;/h2-14,19H,1H3,(H,25,28)(H,30,31)(H,23,26,29);1H2/t19-;/m0./s1 |
| InChIKey | SXCYVQSDJRNYEF-FYZYNONXSA-N |
| XLogP | 2.11 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|