C14H6F3I4NO8S — CID 160974711
2,3,4,5-tetraiodo-6-[[3-oxo-3-(1,1,1-trifluoro-3-sulfopropan-2-yl)oxyprop-1-ynyl]carbamoyl]benzoic acid (PubChem CID 160974711) has the molecular formula C14H6F3I4NO8S and a molecular weight of 912.88 g/mol. Its IUPAC name is 2,3,4,5-tetraiodo-6-[[3-oxo-3-(1,1,1-trifluoro-3-sulfopropan-2-yl)oxyprop-1-ynyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetraiodo-6-[[3-oxo-3-(1,1,1-trifluoro-3-sulfopropan-2-yl)oxyprop-1-ynyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 160974711 |
| Molecular Formula | C14H6F3I4NO8S |
| Molecular Weight | 912.88 g/mol |
| Exact Mass | 912.59 |
| IUPAC Name | 2,3,4,5-tetraiodo-6-[[3-oxo-3-(1,1,1-trifluoro-3-sulfopropan-2-yl)oxyprop-1-ynyl]carbamoyl]benzoic acid |
| SMILES | O=C(C#CNC(=O)c1c(I)c(I)c(I)c(I)c1C(=O)O)OC(CS(=O)(=O)O)C(F)(F)F |
| InChI | InChI=1S/C14H6F3I4NO8S/c15-14(16,17)4(3-31(27,28)29)30-5(23)1-2-22-12(24)6-7(13(25)26)9(19)11(21)10(20)8(6)18/h4H,3H2,(H,22,24)(H,25,26)(H,27,28,29) |
| InChIKey | BKFNJBYXLZCVHP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 147.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.88 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|