C50H132O8 — CID 160996224
hexakis(butan-2-one);6-hydroxy-3,5-dimethyloctan-2-one;methane (PubChem CID 160996224) has the molecular formula C50H132O8 and a molecular weight of 861.60 g/mol. Its IUPAC name is hexakis(butan-2-one);6-hydroxy-3,5-dimethyloctan-2-one;methane.
| Compound Name | hexakis(butan-2-one);6-hydroxy-3,5-dimethyloctan-2-one;methane |
|---|---|
| PubChem CID | 160996224 |
| Molecular Formula | C50H132O8 |
| Molecular Weight | 861.60 g/mol |
| Exact Mass | 860.99 |
| IUPAC Name | hexakis(butan-2-one);6-hydroxy-3,5-dimethyloctan-2-one;methane |
| SMILES | C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.CCC(C)=O.CCC(C)=O.CCC(C)=O.CCC(C)=O.CCC(C)=O.CCC(C)=O.CCC(O)C(C)CC(C)C(C)=O |
| InChI | InChI=1S/C10H20O2.6C4H8O.16CH4/c1-5-10(12)8(3)6-7(2)9(4)11;6*1-3-4(2)5;;;;;;;;;;;;;;;;/h7-8,10,12H,5-6H2,1-4H3;6*3H2,1-2H3;16*1H4 |
| InChIKey | TVGYCCUREBWKBC-UHFFFAOYSA-N |
| XLogP | 18.10 |
| TPSA | 139.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.60 |
| LogP ≤ 5 | 18.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |