C22H23Br2F4NO3S — CID 161004379
[4-(4-bromophenyl)-4,4-difluorobutyl] methanesulfonate;5-(4-bromophenyl)-5,5-difluoropentanenitrile (PubChem CID 161004379) has the molecular formula C22H23Br2F4NO3S and a molecular weight of 617.30 g/mol. Its IUPAC name is [4-(4-bromophenyl)-4,4-difluorobutyl] methanesulfonate;5-(4-bromophenyl)-5,5-difluoropentanenitrile.
| Compound Name | [4-(4-bromophenyl)-4,4-difluorobutyl] methanesulfonate;5-(4-bromophenyl)-5,5-difluoropentanenitrile |
|---|---|
| PubChem CID | 161004379 |
| Molecular Formula | C22H23Br2F4NO3S |
| Molecular Weight | 617.30 g/mol |
| Exact Mass | 614.97 |
| IUPAC Name | [4-(4-bromophenyl)-4,4-difluorobutyl] methanesulfonate;5-(4-bromophenyl)-5,5-difluoropentanenitrile |
| SMILES | CS(=O)(=O)OCCCC(F)(F)c1ccc(Br)cc1.N#CCCCC(F)(F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H10BrF2N.C11H13BrF2O3S/c12-10-5-3-9(4-6-10)11(13,14)7-1-2-8-15;1-18(15,16)17-8-2-7-11(13,14)9-3-5-10(12)6-4-9/h3-6H,1-2,7H2;3-6H,2,7-8H2,1H3 |
| InChIKey | TWHRZBKHGCPWEF-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.30 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|