C29H30F6N4O5 — CID 161014602
6-methanehydrazonoyl-N-[1-(2-methylpropyl)-1,2,3,4-tetrahydroisoquinolin-6-yl]naphthalene-2-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 161014602) has the molecular formula C29H30F6N4O5 and a molecular weight of 628.57 g/mol. Its IUPAC name is 6-methanehydrazonoyl-N-[1-(2-methylpropyl)-1,2,3,4-tetrahydroisoquinolin-6-yl]naphthalene-2-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 6-methanehydrazonoyl-N-[1-(2-methylpropyl)-1,2,3,4-tetrahydroisoquinolin-6-yl]naphthalene-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 161014602 |
| Molecular Formula | C29H30F6N4O5 |
| Molecular Weight | 628.57 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | 6-methanehydrazonoyl-N-[1-(2-methylpropyl)-1,2,3,4-tetrahydroisoquinolin-6-yl]naphthalene-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CC(C)CC1NCCc2cc(NC(=O)c3ccc4cc(C=NN)ccc4c3)ccc21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H28N4O.2C2HF3O2/c1-16(2)11-24-23-8-7-22(14-20(23)9-10-27-24)29-25(30)21-6-5-18-12-17(15-28-26)3-4-19(18)13-21;2*3-2(4,5)1(6)7/h3-8,12-16,24,27H,9-11,26H2,1-2H3,(H,29,30);2*(H,6,7) |
| InChIKey | TXOGOSOYGNHBLA-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 154.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.57 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|