C21H13Br3O5 — CID 161017484
3-(2-phenylethenyl)furan-2,5-dione;(2,4,6-tribromophenyl) prop-2-enoate (PubChem CID 161017484) has the molecular formula C21H13Br3O5 and a molecular weight of 585.04 g/mol. Its IUPAC name is 3-(2-phenylethenyl)furan-2,5-dione;(2,4,6-tribromophenyl) prop-2-enoate.
| Compound Name | 3-(2-phenylethenyl)furan-2,5-dione;(2,4,6-tribromophenyl) prop-2-enoate |
|---|---|
| PubChem CID | 161017484 |
| Molecular Formula | C21H13Br3O5 |
| Molecular Weight | 585.04 g/mol |
| Exact Mass | 581.83 |
| IUPAC Name | 3-(2-phenylethenyl)furan-2,5-dione;(2,4,6-tribromophenyl) prop-2-enoate |
| SMILES | C=CC(=O)Oc1c(Br)cc(Br)cc1Br.O=C1C=C(C=Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C12H8O3.C9H5Br3O2/c13-11-8-10(12(14)15-11)7-6-9-4-2-1-3-5-9;1-2-8(13)14-9-6(11)3-5(10)4-7(9)12/h1-8H;2-4H,1H2 |
| InChIKey | TXXMJONAWMBUNL-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.04 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|