About deuterio(methyl)borinothioic acid;(3R)-3-tritiooxybutan-2-one
deuterio(methyl)borinothioic acid;(3R)-3-tritiooxybutan-2-one (PubChem CID 161020430) has the molecular formula C5H13BO2S
and a molecular weight of 151.05 g/mol. Its IUPAC name is deuterio(methyl)borinothioic acid;(3R)-3-tritiooxybutan-2-one.
Molecular Properties
| Compound Name | deuterio(methyl)borinothioic acid;(3R)-3-tritiooxybutan-2-one |
| PubChem CID | 161020430 |
| Molecular Formula | C5H13BO2S |
| Molecular Weight | 151.05 g/mol |
| Exact Mass | 151.09 |
| IUPAC Name | deuterio(methyl)borinothioic acid;(3R)-3-tritiooxybutan-2-one |
| SMILES | [2H]B(C)S.[3H]O[C@H](C)C(C)=O |
| InChI | InChI=1S/C4H8O2.CH5BS/c1-3(5)4(2)6;1-2-3/h3,5H,1-2H3;2-3H,1H3/t3-;/m1./s1/i5T;2D |
| InChIKey | TYHGDODRXMMVNK-WMSDABBUSA-N |
| XLogP | 0.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.05 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze deuterio(methyl)borinothioic acid;(3R)-3-tritiooxybutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuterio(methyl)borinothioic acid;(3R)-3-tritiooxybutan-2-one?
The IUPAC name of deuterio(methyl)borinothioic acid;(3R)-3-tritiooxybutan-2-one (CID 161020430) is deuterio(methyl)borinothioic acid;(3R)-3-tritiooxybutan-2-one.
What is the SMILES notation for deuterio(methyl)borinothioic acid;(3R)-3-tritiooxybutan-2-one?
The canonical SMILES for deuterio(methyl)borinothioic acid;(3R)-3-tritiooxybutan-2-one is [2H]B(C)S.[3H]O[C@H](C)C(C)=O.
What is the InChIKey of deuterio(methyl)borinothioic acid;(3R)-3-tritiooxybutan-2-one?
The InChIKey is TYHGDODRXMMVNK-WMSDABBUSA-N. The full InChI is InChI=1S/C4H8O2.CH5BS/c1-3(5)4(2)6;1-2-3/h3,5H,1-2H3;2-3H,1H3/t3-;/m1./s1/i5T;2D.
What are the key properties of deuterio(methyl)borinothioic acid;(3R)-3-tritiooxybutan-2-one?
deuterio(methyl)borinothioic acid;(3R)-3-tritiooxybutan-2-one has a molecular weight of 151.05 g/mol, XLogP of 0.27, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for deuterio(methyl)borinothioic acid;(3R)-3-tritiooxybutan-2-one is sourced from PubChem (CID 161020430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).