About methyl(3-oxobutan-2-yl)azanide;rubidium(1+)
methyl(3-oxobutan-2-yl)azanide;rubidium(1+) (PubChem CID 177242198) has the molecular formula C5H10NORb
and a molecular weight of 185.61 g/mol. Its IUPAC name is methyl(3-oxobutan-2-yl)azanide;rubidium(1+).
Molecular Properties
| Compound Name | methyl(3-oxobutan-2-yl)azanide;rubidium(1+) |
| PubChem CID | 177242198 |
| Molecular Formula | C5H10NORb |
| Molecular Weight | 185.61 g/mol |
| Exact Mass | 184.99 |
| IUPAC Name | methyl(3-oxobutan-2-yl)azanide;rubidium(1+) |
| SMILES | C[N-]C(C)C(C)=O.[Rb+] |
| InChI | InChI=1S/C5H10NO.Rb/c1-4(6-3)5(2)7;/h4H,1-3H3;/q-1;+1 |
| InChIKey | SEXZWUOEDUFBLO-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 31.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.61 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methyl(3-oxobutan-2-yl)azanide;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl(3-oxobutan-2-yl)azanide;rubidium(1+)?
The IUPAC name of methyl(3-oxobutan-2-yl)azanide;rubidium(1+) (CID 177242198) is methyl(3-oxobutan-2-yl)azanide;rubidium(1+).
What is the SMILES notation for methyl(3-oxobutan-2-yl)azanide;rubidium(1+)?
The canonical SMILES for methyl(3-oxobutan-2-yl)azanide;rubidium(1+) is C[N-]C(C)C(C)=O.[Rb+].
What is the InChIKey of methyl(3-oxobutan-2-yl)azanide;rubidium(1+)?
The InChIKey is SEXZWUOEDUFBLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10NO.Rb/c1-4(6-3)5(2)7;/h4H,1-3H3;/q-1;+1.
What are the key properties of methyl(3-oxobutan-2-yl)azanide;rubidium(1+)?
methyl(3-oxobutan-2-yl)azanide;rubidium(1+) has a molecular weight of 185.61 g/mol, XLogP of -2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methyl(3-oxobutan-2-yl)azanide;rubidium(1+) is sourced from PubChem (CID 177242198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).