About acetyl(methyl)azanide;rubidium(1+)
acetyl(methyl)azanide;rubidium(1+) (PubChem CID 59953041) has the molecular formula C3H6NORb
and a molecular weight of 157.56 g/mol. Its IUPAC name is acetyl(methyl)azanide;rubidium(1+).
Molecular Properties
| Compound Name | acetyl(methyl)azanide;rubidium(1+) |
| PubChem CID | 59953041 |
| Molecular Formula | C3H6NORb |
| Molecular Weight | 157.56 g/mol |
| Exact Mass | 156.96 |
| IUPAC Name | acetyl(methyl)azanide;rubidium(1+) |
| SMILES | C[N-]C(C)=O.[Rb+] |
| InChI | InChI=1S/C3H7NO.Rb/c1-3(5)4-2;/h1-2H3,(H,4,5);/q;+1/p-1 |
| InChIKey | LUTZDJALAKCYIY-UHFFFAOYSA-M |
| XLogP | -2.46 |
| TPSA | 31.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.56 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetyl(methyl)azanide;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl(methyl)azanide;rubidium(1+)?
The IUPAC name of acetyl(methyl)azanide;rubidium(1+) (CID 59953041) is acetyl(methyl)azanide;rubidium(1+).
What is the SMILES notation for acetyl(methyl)azanide;rubidium(1+)?
The canonical SMILES for acetyl(methyl)azanide;rubidium(1+) is C[N-]C(C)=O.[Rb+].
What is the InChIKey of acetyl(methyl)azanide;rubidium(1+)?
The InChIKey is LUTZDJALAKCYIY-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H7NO.Rb/c1-3(5)4-2;/h1-2H3,(H,4,5);/q;+1/p-1.
What are the key properties of acetyl(methyl)azanide;rubidium(1+)?
acetyl(methyl)azanide;rubidium(1+) has a molecular weight of 157.56 g/mol, XLogP of -2.46, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl(methyl)azanide;rubidium(1+) is sourced from PubChem (CID 59953041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).