About methyl(propanoyl)azanide;rubidium(1+)
methyl(propanoyl)azanide;rubidium(1+) (PubChem CID 59073010) has the molecular formula C4H8NORb
and a molecular weight of 171.58 g/mol. Its IUPAC name is methyl(propanoyl)azanide;rubidium(1+).
Molecular Properties
| Compound Name | methyl(propanoyl)azanide;rubidium(1+) |
| PubChem CID | 59073010 |
| Molecular Formula | C4H8NORb |
| Molecular Weight | 171.58 g/mol |
| Exact Mass | 170.97 |
| IUPAC Name | methyl(propanoyl)azanide;rubidium(1+) |
| SMILES | CCC(=O)[N-]C.[Rb+] |
| InChI | InChI=1S/C4H9NO.Rb/c1-3-4(6)5-2;/h3H2,1-2H3,(H,5,6);/q;+1/p-1 |
| InChIKey | HQHJQDLFTGXYFT-UHFFFAOYSA-M |
| XLogP | -2.07 |
| TPSA | 31.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.58 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methyl(propanoyl)azanide;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl(propanoyl)azanide;rubidium(1+)?
The IUPAC name of methyl(propanoyl)azanide;rubidium(1+) (CID 59073010) is methyl(propanoyl)azanide;rubidium(1+).
What is the SMILES notation for methyl(propanoyl)azanide;rubidium(1+)?
The canonical SMILES for methyl(propanoyl)azanide;rubidium(1+) is CCC(=O)[N-]C.[Rb+].
What is the InChIKey of methyl(propanoyl)azanide;rubidium(1+)?
The InChIKey is HQHJQDLFTGXYFT-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H9NO.Rb/c1-3-4(6)5-2;/h3H2,1-2H3,(H,5,6);/q;+1/p-1.
What are the key properties of methyl(propanoyl)azanide;rubidium(1+)?
methyl(propanoyl)azanide;rubidium(1+) has a molecular weight of 171.58 g/mol, XLogP of -2.07, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methyl(propanoyl)azanide;rubidium(1+) is sourced from PubChem (CID 59073010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).